CAS 1173020-86-4 appears in our catalog under these names: 5-Hydroxymebendazole-d3, D3-Hydroxymebendazole, Concentration: 100 µg/ml Solvent: Acetonitrile, D3-Hydroxymebendazole. Offered by: Chemat Brand, TRC, HPC Standards, MedChemExpress. Available pack sizes: on request, 25mg, 1x1ml, 1x10mg, 5mg, 1mg.
Trideuteriomethyl N-[6-[hydroxy(phenyl)methyl]-1H-benzimidazol-2-yl]carbamate (CAS 1173020-86-4) is a chemical compound with the molecular formula C16H15N3O3 and a molecular weight of 300.33 g/mol. IUPAC name: trideuteriomethyl N-[6-[hydroxy(phenyl)methyl]-1H-benzimidazol-2-yl]carbamate. InChIKey: IIQKUGXEGMZCLE-FIBGUPNXSA-N.
| Molecular formula | C16H15N3O3 |
|---|---|
| Molecular weight | 300.33 g/mol |
| IUPAC name | trideuteriomethyl N-[6-[hydroxy(phenyl)methyl]-1H-benzimidazol-2-yl]carbamate |
| InChIKey | IIQKUGXEGMZCLE-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)NC1=NC2=C(N1)C=C(C=C2)C(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)