CAS 2088431-64-3 is the registry number for 2,2'-((4-Methoxy-2-nitrophenyl)methylene)bis(1H-pyrrole), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4-methoxy-2-nitrophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole (CAS 2088431-64-3) is a chemical compound with the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. IUPAC name: 2-[(4-methoxy-2-nitrophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole. InChIKey: RLPVWDFXNPDQII-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O3 |
|---|---|
| Molecular weight | 297.31 g/mol |
| IUPAC name | 2-[(4-methoxy-2-nitrophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole |
| InChIKey | RLPVWDFXNPDQII-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(C2=CC=CN2)C3=CC=CN3)[N+](=O)[O-] |
Computed by PubChem (NCBI)