CAS 937597-68-7 is the registry number for 6-(3-Methoxyphenyl)-1,3-dimethyl-1H-pyrazolo(3,4-b)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
6-(3-methoxyphenyl)-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxylic acid (CAS 937597-68-7) is a chemical compound with the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. IUPAC name: 6-(3-methoxyphenyl)-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: DEYQZQNEGUCOMX-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O3 |
|---|---|
| Molecular weight | 297.31 g/mol |
| IUPAC name | 6-(3-methoxyphenyl)-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | DEYQZQNEGUCOMX-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=CC(=N2)C3=CC(=CC=C3)OC)C(=O)O)C |
Computed by PubChem (NCBI)