CAS 937606-37-6 is the registry number for 2-(4-(3-Methoxyphenyl)-3-methyl-1H-pyrazolo(3,4-b)pyridin-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-[4-(3-methoxyphenyl)-3-methylpyrazolo[3,4-b]pyridin-1-yl]acetic acid (CAS 937606-37-6) is a chemical compound with the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. IUPAC name: 2-[4-(3-methoxyphenyl)-3-methylpyrazolo[3,4-b]pyridin-1-yl]acetic acid. InChIKey: OYHZKVXKHLERFI-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O3 |
|---|---|
| Molecular weight | 297.31 g/mol |
| IUPAC name | 2-[4-(3-methoxyphenyl)-3-methylpyrazolo[3,4-b]pyridin-1-yl]acetic acid |
| InChIKey | OYHZKVXKHLERFI-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=NC=CC(=C12)C3=CC(=CC=C3)OC)CC(=O)O |
Computed by PubChem (NCBI)