CAS 1173022-56-4 appears in our catalog under these names: 4–Hydroxymephenytoin D3, 4-Hydroxy Mephenytoin-d3, 4-Hydroxymephenytoin-d3, 99.05%, (+/-)-4-Hydroxy Mephenytoin-d3, >95% (HPLC). Offered by: GLPBio, Chemat Brand, MedChemExpress, TRC. Available pack sizes: 5mg, on request, 5 mg, 10 mg, 1 mg, 2,5mg, 25mg.
5-ethyl-5-(4-hydroxyphenyl)-3-(trideuteriomethyl)imidazolidine-2,4-dione (CAS 1173022-56-4) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 237.27 g/mol. IUPAC name: 5-ethyl-5-(4-hydroxyphenyl)-3-(trideuteriomethyl)imidazolidine-2,4-dione. InChIKey: OQPLORUDZLXXPD-BMSJAHLVSA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 237.27 g/mol |
| IUPAC name | 5-ethyl-5-(4-hydroxyphenyl)-3-(trideuteriomethyl)imidazolidine-2,4-dione |
| InChIKey | OQPLORUDZLXXPD-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)C(NC1=O)(CC)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)