Products 1173023-03-4
CAS 1173023-03-4 is the registry number for Alpha-Keto Isovaleric Acid-13C Sodium Salt. Offered by: TRC. Available pack sizes: 25mg.
Sodium 3-methyl-2-oxo(113C)butanoate (CAS 1173023-03-4) is a chemical compound with the molecular formula C5H7NaO3 and a molecular weight of 139.09 g/mol. IUPAC name: sodium 3-methyl-2-oxo(113C)butanoate. InChIKey: WIQBZDCJCRFGKA-LJJZSEGWSA-M.
| Molecular formula | C5H7NaO3 |
|---|---|
| Molecular weight | 139.09 g/mol |
| IUPAC name | sodium 3-methyl-2-oxo(113C)butanoate |
| InChIKey | WIQBZDCJCRFGKA-LJJZSEGWSA-M |
| SMILES | CC(C)C(=O)[13C](=O)[O-].[Na+] |
Computed by PubChem (NCBI)