Products 1185115-88-1
CAS 1185115-88-1 appears in our catalog under these names: Sodium 3–methyl–2–oxobutanoate–13C4,d4, 3-Methyl-2-oxobutanoic acid-13C4,d4 (sodium), 98.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25 mg, 5 mg, 10 mg.
Sodium 3,4,4,4-tetradeuterio-3-(113C)methyl-2-oxo(1,2,3-13C3)butanoate (CAS 1185115-88-1) is a chemical compound with the molecular formula C5H7NaO3 and a molecular weight of 146.092 g/mol. IUPAC name: sodium 3,4,4,4-tetradeuterio-3-(113C)methyl-2-oxo(1,2,3-13C3)butanoate. InChIKey: WIQBZDCJCRFGKA-XCPSOYJTSA-M.
| Molecular formula | C5H7NaO3 |
|---|---|
| Molecular weight | 146.092 g/mol |
| IUPAC name | sodium 3,4,4,4-tetradeuterio-3-(113C)methyl-2-oxo(1,2,3-13C3)butanoate |
| InChIKey | WIQBZDCJCRFGKA-XCPSOYJTSA-M |
| SMILES | [2H]C([2H])([2H])[13C]([2H])([13CH3])[13C](=O)[13C](=O)[O-].[Na+] |
Computed by PubChem (NCBI)