Products 1216972-87-0
CAS 1216972-87-0 is the registry number for Sodium 3-methyl-2-oxobutanoate-13C2,d1, 99.00%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 50 mg.
Sodium 3-deuterio-3-(113C)methyl-2-oxo(413C)butanoate (CAS 1216972-87-0) is a chemical compound with the molecular formula C5H7NaO3 and a molecular weight of 141.09 g/mol. IUPAC name: sodium 3-deuterio-3-(113C)methyl-2-oxo(413C)butanoate. InChIKey: WIQBZDCJCRFGKA-VQUYYKNDSA-M.
| Molecular formula | C5H7NaO3 |
|---|---|
| Molecular weight | 141.09 g/mol |
| IUPAC name | sodium 3-deuterio-3-(113C)methyl-2-oxo(413C)butanoate |
| InChIKey | WIQBZDCJCRFGKA-VQUYYKNDSA-M |
| SMILES | [2H]C([13CH3])([13CH3])C(=O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)