CAS 1215605-14-3 is the registry number for Sodium 3-methyl-2-oxobutanoate-13C4,d3. Offered by: MedChemExpress. Available pack sizes: 1 mg.
Sodium 4,4,4-trideuterio-3-(113C)methyl-2-oxo(1,2,3-13C3)butanoate (CAS 1215605-14-3) is a chemical compound with the molecular formula C5H7NaO3 and a molecular weight of 145.086 g/mol. IUPAC name: sodium 4,4,4-trideuterio-3-(113C)methyl-2-oxo(1,2,3-13C3)butanoate. InChIKey: WIQBZDCJCRFGKA-SSBGHZRHSA-M.
| Molecular formula | C5H7NaO3 |
|---|---|
| Molecular weight | 145.086 g/mol |
| IUPAC name | sodium 4,4,4-trideuterio-3-(113C)methyl-2-oxo(1,2,3-13C3)butanoate |
| InChIKey | WIQBZDCJCRFGKA-SSBGHZRHSA-M |
| SMILES | [2H]C([2H])([2H])[13CH]([13CH3])[13C](=O)[13C](=O)[O-].[Na+] |
Computed by PubChem (NCBI)