CAS 1173087-54-1 is the registry number for trans-1-(tert-Butoxycarbonyl)-3-fluoropyrrolidine-2-carboxylic acid, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
(2R,3S)-3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 1173087-54-1) is a chemical compound with the molecular formula C10H16FNO4 and a molecular weight of 233.24 g/mol. IUPAC name: (2R,3S)-3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: BUNHNBQISAFFOR-BQBZGAKWSA-N.
| Molecular formula | C10H16FNO4 |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | (2R,3S)-3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | BUNHNBQISAFFOR-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@H]1C(=O)O)F |
Computed by PubChem (NCBI)