Products 117309-43-0

CAS 117309-43-0 is the registry number for N-(4-Methoxyphenyl)-n-(phenylsulfonyl)glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[N-(benzenesulfonyl)-4-methoxyanilino]acetic acid (CAS 117309-43-0) is a chemical compound with the molecular formula C15H15NO5S and a molecular weight of 321.3 g/mol. IUPAC name: 2-[N-(benzenesulfonyl)-4-methoxyanilino]acetic acid. InChIKey: XJVMWSBOCNRPNF-UHFFFAOYSA-N.

Identity
Molecular formulaC15H15NO5S
Molecular weight321.3 g/mol
IUPAC name2-[N-(benzenesulfonyl)-4-methoxyanilino]acetic acid
InChIKeyXJVMWSBOCNRPNF-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)N(CC(=O)O)S(=O)(=O)C2=CC=CC=C2

Computed by PubChem (NCBI)