CAS 332163-07-2 appears in our catalog under these names: 4,5-Dimethoxy-2-(2-thiophen-2-yl-acetylamino)-benzoic acid, 4,5-Dimethoxy-2-[(thien-2-ylacetyl)amino]benzoic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 10g, 1g, 5g, 250mg.
4,5-dimethoxy-2-[(2-thiophen-2-ylacetyl)amino]benzoic acid (CAS 332163-07-2) is a chemical compound with the molecular formula C15H15NO5S and a molecular weight of 321.3 g/mol. IUPAC name: 4,5-dimethoxy-2-[(2-thiophen-2-ylacetyl)amino]benzoic acid. InChIKey: HJIRMBCDMYOXQI-UHFFFAOYSA-N.
| Molecular formula | C15H15NO5S |
|---|---|
| Molecular weight | 321.3 g/mol |
| IUPAC name | 4,5-dimethoxy-2-[(2-thiophen-2-ylacetyl)amino]benzoic acid |
| InChIKey | HJIRMBCDMYOXQI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)NC(=O)CC2=CC=CS2)OC |
Computed by PubChem (NCBI)