CAS 251096-79-4 is the registry number for 2-(4-Chlorobenzenesulfonamido)-2-phenylacetic acid. Offered by: Biosynth. Available pack sizes: 2,5g.
2-[(4-chlorophenyl)sulfonylamino]-2-phenylacetic acid (CAS 251096-79-4) is a chemical compound with the molecular formula C14H12ClNO4S and a molecular weight of 325.8 g/mol. IUPAC name: 2-[(4-chlorophenyl)sulfonylamino]-2-phenylacetic acid. InChIKey: RCGHLRLGTZRRKK-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO4S |
|---|---|
| Molecular weight | 325.8 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)sulfonylamino]-2-phenylacetic acid |
| InChIKey | RCGHLRLGTZRRKK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)NS(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)