CAS 1173110-88-7 appears in our catalog under these names: (R)–3–Methyl–1–phenylbutan–1–amine, (R)-3-Methyl-1-phenylbutan-1-amine hydrochloride, 98%. Offered by: GLPBio, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
(1R)-3-methyl-1-phenylbutan-1-amine;hydrochloride (CAS 1173110-88-7) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (1R)-3-methyl-1-phenylbutan-1-amine;hydrochloride. InChIKey: HNQTWZNKDACDLN-RFVHGSKJSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (1R)-3-methyl-1-phenylbutan-1-amine;hydrochloride |
| InChIKey | HNQTWZNKDACDLN-RFVHGSKJSA-N |
| SMILES | CC(C)C[C@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)