CAS 1269470-38-3 appears in our catalog under these names: (S)–3–Methyl–1–phenylbutan–1–amine hydrochloride, (S)-3-Methyl-1-phenylbutan-1-amine hydrochloride, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1S)-3-methyl-1-phenylbutan-1-amine;hydrochloride (CAS 1269470-38-3) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (1S)-3-methyl-1-phenylbutan-1-amine;hydrochloride. InChIKey: HNQTWZNKDACDLN-MERQFXBCSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (1S)-3-methyl-1-phenylbutan-1-amine;hydrochloride |
| InChIKey | HNQTWZNKDACDLN-MERQFXBCSA-N |
| SMILES | CC(C)C[C@@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)