Products 1173174-03-2

CAS 1173174-03-2 is the registry number for (2R,4R)-4-Phenylpyrrolidine-2-carboxylic acid hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2R,4R)-4-phenylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 1173174-03-2) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: (2R,4R)-4-phenylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: LWFBRHSTNWMMGN-BAUSSPIASA-N.

Identity
Molecular formulaC11H14ClNO2
Molecular weight227.69 g/mol
IUPAC name(2R,4R)-4-phenylpyrrolidine-2-carboxylic acid;hydrochloride
InChIKeyLWFBRHSTNWMMGN-BAUSSPIASA-N
SMILESC1[C@@H](CN[C@H]1C(=O)O)C2=CC=CC=C2.Cl

Computed by PubChem (NCBI)