CAS 1173202-49-7 appears in our catalog under these names: tert-Butyl (4S)-4-ethyl-2,2-dioxo-1,2,3-oxathiazolidine-3-carboxylate, 97%, (S)-3-Boc-4-ethyl-1,2,3-oxathiazolidine 2,2-dioxide, (S)-3-Boc-4-Ethyl-2,2-Dioxo-[1,2,3]Oxathiazolidine, 97%, 97%, (S)-TERT-BUTYL 4-ETHYL-1,2,3-OXATHIAZOLIDINE-3-CARBOXYLATE 2,2-DIOXIDE, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg.
Tert-butyl (4S)-4-ethyl-2,2-dioxooxathiazolidine-3-carboxylate (CAS 1173202-49-7) is a chemical compound with the molecular formula C9H17NO5S and a molecular weight of 251.30 g/mol. IUPAC name: tert-butyl (4S)-4-ethyl-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: RGMWNSRIFDGQIH-ZETCQYMHSA-N.
| Molecular formula | C9H17NO5S |
|---|---|
| Molecular weight | 251.30 g/mol |
| IUPAC name | tert-butyl (4S)-4-ethyl-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | RGMWNSRIFDGQIH-ZETCQYMHSA-N |
| SMILES | CC[C@H]1COS(=O)(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)