CAS 1311368-79-2 is the registry number for tert-Butyl 4,5-dimethyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4,5-dimethyl-2,2-dioxooxathiazolidine-3-carboxylate (CAS 1311368-79-2) is a chemical compound with the molecular formula C9H17NO5S and a molecular weight of 251.30 g/mol. IUPAC name: tert-butyl 4,5-dimethyl-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: DFHZSSNBXABYPY-UHFFFAOYSA-N.
| Molecular formula | C9H17NO5S |
|---|---|
| Molecular weight | 251.30 g/mol |
| IUPAC name | tert-butyl 4,5-dimethyl-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | DFHZSSNBXABYPY-UHFFFAOYSA-N |
| SMILES | CC1C(OS(=O)(=O)N1C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)