CAS 1956378-90-7 appears in our catalog under these names: tert-Butyl 5,5-dimethyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 95%, 3-Boc-5,5-dimethyl-1,2,3-oxathiazolidine 2,2-Dioxide, tert-Butyl 5,5-dimethyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, ≥95%, ≥95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 0,5g, 10g.
Tert-butyl 5,5-dimethyl-2,2-dioxooxathiazolidine-3-carboxylate (CAS 1956378-90-7) is a chemical compound with the molecular formula C9H17NO5S and a molecular weight of 251.30 g/mol. IUPAC name: tert-butyl 5,5-dimethyl-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: BYIAWCYJBINANP-UHFFFAOYSA-N.
| Molecular formula | C9H17NO5S |
|---|---|
| Molecular weight | 251.30 g/mol |
| IUPAC name | tert-butyl 5,5-dimethyl-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | BYIAWCYJBINANP-UHFFFAOYSA-N |
| SMILES | CC1(CN(S(=O)(=O)O1)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)