CAS 1240398-27-9 appears in our catalog under these names: N-Acetyl-S-(3,4-dihydroxybutyl)-L-cysteine-d7 (Mixture of Diastereomers), >95% (HPLC), N-Acetyl-S-(3,4-dihydroxybutyl)-L-cysteine-d7. Offered by: TRC, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 5mg, 1 mg.
(2R)-2-acetamido-3-(1,1,2,2,3,4,4-heptadeuterio-3,4-dihydroxybutyl)sulfanylpropanoic acid (CAS 1240398-27-9) is a chemical compound with the molecular formula C9H17NO5S and a molecular weight of 258.35 g/mol. IUPAC name: (2R)-2-acetamido-3-(1,1,2,2,3,4,4-heptadeuterio-3,4-dihydroxybutyl)sulfanylpropanoic acid. InChIKey: VGJNEDFZFZCLSX-NCUHYACUSA-N.
| Molecular formula | C9H17NO5S |
|---|---|
| Molecular weight | 258.35 g/mol |
| IUPAC name | (2R)-2-acetamido-3-(1,1,2,2,3,4,4-heptadeuterio-3,4-dihydroxybutyl)sulfanylpropanoic acid |
| InChIKey | VGJNEDFZFZCLSX-NCUHYACUSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])SC[C@@H](C(=O)O)NC(=O)C)C([2H])(C([2H])([2H])O)O |
Computed by PubChem (NCBI)