CAS 117391-51-2 appears in our catalog under these names: 3–Amino–3–(3–fluorophenyl)propanoic acid, 3-Amino-3-(3-Fluorophenyl)Propanoic Acid, 97%, 97%, 3-Amino-3-(3-fluorophenyl)propanoic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 1g, 5g.
3-amino-3-(3-fluorophenyl)propanoic acid (CAS 117391-51-2) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: 3-amino-3-(3-fluorophenyl)propanoic acid. InChIKey: GZNJUJNKZBHINS-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | 3-amino-3-(3-fluorophenyl)propanoic acid |
| InChIKey | GZNJUJNKZBHINS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(CC(=O)O)N |
Computed by PubChem (NCBI)