CAS 723284-81-9 appears in our catalog under these names: (R)-3-Amino-3-(3-fluoro-phenyl)-propionic acid, 95%, 95%, H-D-β-Phe(3-F)-OH, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
(3R)-3-amino-3-(3-fluorophenyl)propanoic acid (CAS 723284-81-9) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: (3R)-3-amino-3-(3-fluorophenyl)propanoic acid. InChIKey: GZNJUJNKZBHINS-MRVPVSSYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | (3R)-3-amino-3-(3-fluorophenyl)propanoic acid |
| InChIKey | GZNJUJNKZBHINS-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC(=C1)F)[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)