Products 117391-55-6
CAS 117391-55-6 is the registry number for 3-Amino-3-(2,5-dimethylphenyl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-amino-3-(2,5-dimethylphenyl)propanoic acid (CAS 117391-55-6) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 3-amino-3-(2,5-dimethylphenyl)propanoic acid. InChIKey: ORBDRZAPRLVKDA-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 3-amino-3-(2,5-dimethylphenyl)propanoic acid |
| InChIKey | ORBDRZAPRLVKDA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C(CC(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
beta-Amino-2,5-dimethylbenzenepropanoic acid, 3-amino-3-(2,5-dimethylphenyl)propanoic acid, 3-Amino-3-(2,5-dimethyl-phenyl)-propionic acid, Oprea1_836891, ORBDRZAPRLVKDA-UHFFFAOYSA-N, 3-(2,5-Dimethylphenyl)-beta-alanine #, 3-amino-3-(2,5-dimethylphenyl)propanoicacid, I(2)-Amino-2,5-dimethylbenzenepropanoic acid, Benzenepropanoic acid, beta-amino-2,5-dimethyl-