CAS 1213196-94-1 is the registry number for (R)-3-Amino-3-(2,5-dimethylphenyl)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-3-amino-3-(2,5-dimethylphenyl)propanoic acid (CAS 1213196-94-1) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: (3R)-3-amino-3-(2,5-dimethylphenyl)propanoic acid. InChIKey: ORBDRZAPRLVKDA-SNVBAGLBSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | (3R)-3-amino-3-(2,5-dimethylphenyl)propanoic acid |
| InChIKey | ORBDRZAPRLVKDA-SNVBAGLBSA-N |
| SMILES | CC1=CC(=C(C=C1)C)[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)