Products 1174005-63-0

CAS 1174005-63-0 is the registry number for Methyl 3-cyano-1H-1,2,4-triazole-5-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3-cyano-1H-1,2,4-triazole-5-carboxylate (CAS 1174005-63-0) is a chemical compound with the molecular formula C5H4N4O2 and a molecular weight of 152.11 g/mol. IUPAC name: methyl 3-cyano-1H-1,2,4-triazole-5-carboxylate. InChIKey: WYIWDXKDSCFYOF-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4N4O2
Molecular weight152.11 g/mol
IUPAC namemethyl 3-cyano-1H-1,2,4-triazole-5-carboxylate
InChIKeyWYIWDXKDSCFYOF-UHFFFAOYSA-N
SMILESCOC(=O)C1=NC(=NN1)C#N

Computed by PubChem (NCBI)