CAS 117401-68-0 appears in our catalog under these names: 3-((2,2,2-Trifluoroethoxy)methyl)aniline, 95%, 3-((2,2,2-Trifluoroethoxy)methyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-(2,2,2-trifluoroethoxymethyl)aniline (CAS 117401-68-0) is a chemical compound with the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. IUPAC name: 3-(2,2,2-trifluoroethoxymethyl)aniline. InChIKey: IQNICUMDZICMBN-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethoxymethyl)aniline |
| InChIKey | IQNICUMDZICMBN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)COCC(F)(F)F |
Computed by PubChem (NCBI)