CAS 1174038-64-2 appears in our catalog under these names: 1-Benzenesulfonyl-3-bromo-1h-pyrrolo[2,3-c]pyridine, 95%, 3-Bromo-1-(phenylsulfonyl)-1H-pyrrolo(2,3-c)pyridine, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
1-(benzenesulfonyl)-3-bromopyrrolo[2,3-c]pyridine (CAS 1174038-64-2) is a chemical compound with the molecular formula C13H9BrN2O2S and a molecular weight of 337.19 g/mol. IUPAC name: 1-(benzenesulfonyl)-3-bromopyrrolo[2,3-c]pyridine. InChIKey: UJHCWZFEXMXXRZ-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2O2S |
|---|---|
| Molecular weight | 337.19 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-3-bromopyrrolo[2,3-c]pyridine |
| InChIKey | UJHCWZFEXMXXRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=C2C=NC=C3)Br |
Computed by PubChem (NCBI)