CAS 880769-95-9 appears in our catalog under these names: 3-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 95%, 95%, 3-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 95%, 3-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine 95%, 3-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 97%. Offered by: Chemat, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
1-(benzenesulfonyl)-3-bromopyrrolo[2,3-b]pyridine (CAS 880769-95-9) is a chemical compound with the molecular formula C13H9BrN2O2S and a molecular weight of 337.19 g/mol. IUPAC name: 1-(benzenesulfonyl)-3-bromopyrrolo[2,3-b]pyridine. InChIKey: TZTSMNAZKFSLIC-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2O2S |
|---|---|
| Molecular weight | 337.19 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-3-bromopyrrolo[2,3-b]pyridine |
| InChIKey | TZTSMNAZKFSLIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=C2N=CC=C3)Br |
Computed by PubChem (NCBI)