Products 1951444-63-5
CAS 1951444-63-5 is the registry number for 7-Bromo-1-(phenylsulfonyl)-1h-pyrrolo[3,2-c]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1-(benzenesulfonyl)-7-bromopyrrolo[3,2-c]pyridine (CAS 1951444-63-5) is a chemical compound with the molecular formula C13H9BrN2O2S and a molecular weight of 337.19 g/mol. IUPAC name: 1-(benzenesulfonyl)-7-bromopyrrolo[3,2-c]pyridine. InChIKey: ZZDWUXHLJMSRIK-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2O2S |
|---|---|
| Molecular weight | 337.19 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-7-bromopyrrolo[3,2-c]pyridine |
| InChIKey | ZZDWUXHLJMSRIK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=CN=CC(=C32)Br |
Computed by PubChem (NCBI)