Products 1305325-23-8
CAS 1305325-23-8 appears in our catalog under these names: 6-Bromo-1-(phenylsulfonyl)-1h-pyrrolo[3,2-b]pyridine, 95%, 6-Bromo-1-(phenylsulfonyl)-1H-pyrrolo(3,2-b)pyridine, 97%, 6-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine, 97%, 97%, 6-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg, 5g, 10g, 25g.
1-(benzenesulfonyl)-6-bromopyrrolo[3,2-b]pyridine (CAS 1305325-23-8) is a chemical compound with the molecular formula C13H9BrN2O2S and a molecular weight of 337.19 g/mol. IUPAC name: 1-(benzenesulfonyl)-6-bromopyrrolo[3,2-b]pyridine. InChIKey: ZFAXLERNOAWMMA-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2O2S |
|---|---|
| Molecular weight | 337.19 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-6-bromopyrrolo[3,2-b]pyridine |
| InChIKey | ZFAXLERNOAWMMA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2C=C(C=N3)Br |
Computed by PubChem (NCBI)