CAS 1174289-18-9 appears in our catalog under these names: Doxofylline Impurity 3, Doxofylline Impurity 4, 9-(1,3-Dioxolan-2-ylmethyl)-3,9-dihydro-1,3-dimethyl-1H-purine-2,6-dione, >95% (HPLC), 9-(1,3-Dioxolan-2-ylmethyl)-3,9-dihydro-1,3-dimethyl-1H-purine-2,6-dione, 9-(1,3-Dioxolan-2-ylMethyl)-3,9-dihydro-1,3-diMethyl-1H-purine-2,6-dione, 97%, 97%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
9-(1,3-dioxolan-2-ylmethyl)-1,3-dimethylpurine-2,6-dione (CAS 1174289-18-9) is a chemical compound with the molecular formula C11H14N4O4 and a molecular weight of 266.25 g/mol. IUPAC name: 9-(1,3-dioxolan-2-ylmethyl)-1,3-dimethylpurine-2,6-dione. InChIKey: ZIERWCODDLABQQ-UHFFFAOYSA-N.
| Molecular formula | C11H14N4O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 9-(1,3-dioxolan-2-ylmethyl)-1,3-dimethylpurine-2,6-dione |
| InChIKey | ZIERWCODDLABQQ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N=CN2CC3OCCO3 |
Computed by PubChem (NCBI)