CAS 1174428-30-8 is the registry number for 3-(3-Aminophenyl)-5-morpholino-7H-thieno[3,2-b]pyran-7-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-aminophenyl)-5-morpholin-4-ylthieno[3,2-b]pyran-7-one (CAS 1174428-30-8) is a chemical compound with the molecular formula C17H16N2O3S and a molecular weight of 328.4 g/mol. IUPAC name: 3-(3-aminophenyl)-5-morpholin-4-ylthieno[3,2-b]pyran-7-one. InChIKey: JMTOJRFMAPIYKE-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O3S |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 3-(3-aminophenyl)-5-morpholin-4-ylthieno[3,2-b]pyran-7-one |
| InChIKey | JMTOJRFMAPIYKE-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC(=O)C3=C(O2)C(=CS3)C4=CC(=CC=C4)N |
Computed by PubChem (NCBI)