CAS 1391052-01-9 is the registry number for Valdecoxib Impurity 2. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]benzenesulfonamide (CAS 1391052-01-9) is a chemical compound with the molecular formula C17H16N2O3S and a molecular weight of 328.4 g/mol. IUPAC name: 4-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]benzenesulfonamide. InChIKey: FCRHKSWIQHRYFD-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O3S |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 4-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]benzenesulfonamide |
| InChIKey | FCRHKSWIQHRYFD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)CC3=CC=C(C=C3)S(=O)(=O)N |
Computed by PubChem (NCBI)