CAS 1199216-03-9 appears in our catalog under these names: Ethyl 4-methyl-2-[(2-methylquinolin-8-yl)oxy]-1,3-thiazole-5-carboxylate, 95%, Ethyl 4-methyl-2-((2-methylquinolin-8-yl)oxy)-1,3-thiazole-5-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Ethyl 4-methyl-2-(2-methylquinolin-8-yl)oxy-1,3-thiazole-5-carboxylate (CAS 1199216-03-9) is a chemical compound with the molecular formula C17H16N2O3S and a molecular weight of 328.4 g/mol. IUPAC name: ethyl 4-methyl-2-(2-methylquinolin-8-yl)oxy-1,3-thiazole-5-carboxylate. InChIKey: SLHLLZIZHLBRLH-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O3S |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | ethyl 4-methyl-2-(2-methylquinolin-8-yl)oxy-1,3-thiazole-5-carboxylate |
| InChIKey | SLHLLZIZHLBRLH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)OC2=CC=CC3=C2N=C(C=C3)C)C |
Computed by PubChem (NCBI)