Products 697256-66-9
CAS 697256-66-9 is the registry number for 1-(2-Phenylethyl)-4-(2-thienylcarbonyl)-2,6-piperazinedione. Offered by: TRC. Available pack sizes: 1g.
1-(2-phenylethyl)-4-(thiophene-2-carbonyl)piperazine-2,6-dione (CAS 697256-66-9) is a chemical compound with the molecular formula C17H16N2O3S and a molecular weight of 328.4 g/mol. IUPAC name: 1-(2-phenylethyl)-4-(thiophene-2-carbonyl)piperazine-2,6-dione. InChIKey: ZXIODKCXCDMGSY-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O3S |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 1-(2-phenylethyl)-4-(thiophene-2-carbonyl)piperazine-2,6-dione |
| InChIKey | ZXIODKCXCDMGSY-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)CN1C(=O)C2=CC=CS2)CCC3=CC=CC=C3 |
Computed by PubChem (NCBI)