Products 1174540-27-2
CAS 1174540-27-2 is the registry number for (R)-2-(1-Aminoethyl)-3-(4-chlorophenyl)pyrido(2,3-d)pyrimidin-4(3H)-one. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
2-[(1R)-1-aminoethyl]-3-(4-chlorophenyl)pyrido[2,3-d]pyrimidin-4-one (CAS 1174540-27-2) is a chemical compound with the molecular formula C15H13ClN4O and a molecular weight of 300.74 g/mol. IUPAC name: 2-[(1R)-1-aminoethyl]-3-(4-chlorophenyl)pyrido[2,3-d]pyrimidin-4-one. InChIKey: CMRNDXXHVLPJEP-SECBINFHSA-N.
| Molecular formula | C15H13ClN4O |
|---|---|
| Molecular weight | 300.74 g/mol |
| IUPAC name | 2-[(1R)-1-aminoethyl]-3-(4-chlorophenyl)pyrido[2,3-d]pyrimidin-4-one |
| InChIKey | CMRNDXXHVLPJEP-SECBINFHSA-N |
| SMILES | C[C@H](C1=NC2=C(C=CC=N2)C(=O)N1C3=CC=C(C=C3)Cl)N |
Computed by PubChem (NCBI)