Products 1191908-24-3
CAS 1191908-24-3 is the registry number for ADRA1D receptor antagonist 1 (free base). Offered by: MedChemExpress. Available pack sizes: Get quote.
5-chloro-1-[(1R)-1-(3-cyanophenyl)ethyl]-2-iminopyridine-3-carboxamide (CAS 1191908-24-3) is a chemical compound with the molecular formula C15H13ClN4O and a molecular weight of 300.74 g/mol. IUPAC name: 5-chloro-1-[(1R)-1-(3-cyanophenyl)ethyl]-2-iminopyridine-3-carboxamide. InChIKey: CDJPHTNUARAVMH-SECBINFHSA-N.
| Molecular formula | C15H13ClN4O |
|---|---|
| Molecular weight | 300.74 g/mol |
| IUPAC name | 5-chloro-1-[(1R)-1-(3-cyanophenyl)ethyl]-2-iminopyridine-3-carboxamide |
| InChIKey | CDJPHTNUARAVMH-SECBINFHSA-N |
| SMILES | C[C@H](C1=CC=CC(=C1)C#N)N2C=C(C=C(C2=N)C(=O)N)Cl |
Computed by PubChem (NCBI)