CAS 1174764-48-7 appears in our catalog under these names: Ethyl 4-hydroxy-8-isopropyl-6,7-dimethoxy-2-naphthoate, 98%, Ethyl 4-hydroxy-8-isopropyl-6,7-dimethoxy-2-naphthoate, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 25mg, 100mg.
Ethyl 4-hydroxy-6,7-dimethoxy-8-propan-2-ylnaphthalene-2-carboxylate (CAS 1174764-48-7) is a chemical compound with the molecular formula C18H22O5 and a molecular weight of 318.4 g/mol. IUPAC name: ethyl 4-hydroxy-6,7-dimethoxy-8-propan-2-ylnaphthalene-2-carboxylate. InChIKey: BZYUFDYPLRJCBG-UHFFFAOYSA-N.
| Molecular formula | C18H22O5 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | ethyl 4-hydroxy-6,7-dimethoxy-8-propan-2-ylnaphthalene-2-carboxylate |
| InChIKey | BZYUFDYPLRJCBG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C(=C(C=C2C(=C1)O)OC)OC)C(C)C |
Computed by PubChem (NCBI)