Products 223556-59-0
CAS 223556-59-0 is the registry number for Beraprost Impurity 42. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(1S,2S,7R,9S)-5-methyl-4,6,10-trioxatetracyclo[7.7.0.02,7.011,16]hexadeca-11,13,15-trien-12-yl]butanoic acid (CAS 223556-59-0) is a chemical compound with the molecular formula C18H22O5 and a molecular weight of 318.4 g/mol. IUPAC name: 4-[(1S,2S,7R,9S)-5-methyl-4,6,10-trioxatetracyclo[7.7.0.02,7.011,16]hexadeca-11,13,15-trien-12-yl]butanoic acid. InChIKey: DOFBRUFSICLFEY-DKGMZEJRSA-N.
| Molecular formula | C18H22O5 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 4-[(1S,2S,7R,9S)-5-methyl-4,6,10-trioxatetracyclo[7.7.0.02,7.011,16]hexadeca-11,13,15-trien-12-yl]butanoic acid |
| InChIKey | DOFBRUFSICLFEY-DKGMZEJRSA-N |
| SMILES | CC1OC[C@H]2[C@H](O1)C[C@H]3[C@@H]2C4=CC=CC(=C4O3)CCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Beraprost Impurity 42