Products 2274853-20-0

CAS 2274853-20-0 is the registry number for Loxoprofen Impurity 79. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Methyl 2-[[4-(1-methoxy-1-oxopropan-2-yl)phenyl]methoxy]cyclopentene-1-carboxylate (CAS 2274853-20-0) is a chemical compound with the molecular formula C18H22O5 and a molecular weight of 318.4 g/mol. IUPAC name: methyl 2-[[4-(1-methoxy-1-oxopropan-2-yl)phenyl]methoxy]cyclopentene-1-carboxylate. InChIKey: LUPYNCLMDSQVLE-UHFFFAOYSA-N.

Identity
Molecular formulaC18H22O5
Molecular weight318.4 g/mol
IUPAC namemethyl 2-[[4-(1-methoxy-1-oxopropan-2-yl)phenyl]methoxy]cyclopentene-1-carboxylate
InChIKeyLUPYNCLMDSQVLE-UHFFFAOYSA-N
SMILESCC(C1=CC=C(C=C1)COC2=C(CCC2)C(=O)OC)C(=O)OC

Computed by PubChem (NCBI)