Products 36455-70-6
CAS 36455-70-6 appears in our catalog under these names: cis-Zearalenone, cis-Zearalenone, 848.81±158.05ppb, 848.81±158.05ppb. Offered by: Chemat Brand, TRC, Biosynth, Chemat. Available pack sizes: on request, 2,5mg, 50mg, 25mg, 100mg, 250mg, 1g.
(4S,12Z)-16,18-dihydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),12,15,17-tetraene-2,8-dione (CAS 36455-70-6) is a chemical compound with the molecular formula C18H22O5 and a molecular weight of 318.4 g/mol. IUPAC name: (4S,12Z)-16,18-dihydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),12,15,17-tetraene-2,8-dione. InChIKey: MBMQEIFVQACCCH-MIBUCLJRSA-N.
| Molecular formula | C18H22O5 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | (4S,12Z)-16,18-dihydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),12,15,17-tetraene-2,8-dione |
| InChIKey | MBMQEIFVQACCCH-MIBUCLJRSA-N |
| SMILES | C[C@H]1CCCC(=O)CCC/C=C\C2=C(C(=CC(=C2)O)O)C(=O)O1 |
Computed by PubChem (NCBI)