Products 1175002-04-6
CAS 1175002-04-6 appears in our catalog under these names: DMABA–d6 NHS ester, DMABA-d6 NHS ester. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 5 mg, 1 mg.
(2,5-dioxopyrrolidin-1-yl) 4-[bis(trideuteriomethyl)amino]benzoate (CAS 1175002-04-6) is a chemical compound with the molecular formula C13H14N2O4 and a molecular weight of 268.30 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-[bis(trideuteriomethyl)amino]benzoate. InChIKey: FNGFZOAQGYOQTG-WFGJKAKNSA-N.
| Molecular formula | C13H14N2O4 |
|---|---|
| Molecular weight | 268.30 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 4-[bis(trideuteriomethyl)amino]benzoate |
| InChIKey | FNGFZOAQGYOQTG-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(C1=CC=C(C=C1)C(=O)ON2C(=O)CCC2=O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)