Products 1175002-06-8
CAS 1175002-06-8 is the registry number for Methyl 4-(Dimethylamino)benzoate-D4. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 50mg, 5mg, 100 mg, 50 mg, 5 mg.
Methyl 2,3,5,6-tetradeuterio-4-(dimethylamino)benzoate (CAS 1175002-06-8) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 183.24 g/mol. IUPAC name: methyl 2,3,5,6-tetradeuterio-4-(dimethylamino)benzoate. InChIKey: DBQGARDMYOMOOS-UGWFXTGHSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 183.24 g/mol |
| IUPAC name | methyl 2,3,5,6-tetradeuterio-4-(dimethylamino)benzoate |
| InChIKey | DBQGARDMYOMOOS-UGWFXTGHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)OC)[2H])[2H])N(C)C)[2H] |
Computed by PubChem (NCBI)