Products 1175645-00-7
CAS 1175645-00-7 is the registry number for 2-N,2-N-Dimethyl-1,3-benzoxazole-2,5-diamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-N,2-N-dimethyl-1,3-benzoxazole-2,5-diamine (CAS 1175645-00-7) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 2-N,2-N-dimethyl-1,3-benzoxazole-2,5-diamine. InChIKey: DHRXSWCLVPXPSL-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 2-N,2-N-dimethyl-1,3-benzoxazole-2,5-diamine |
| InChIKey | DHRXSWCLVPXPSL-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC2=C(O1)C=CC(=C2)N |
Computed by PubChem (NCBI)