Products 1175834-19-1
CAS 1175834-19-1 appears in our catalog under these names: N-[(4-Aminophenyl)methyl]-4-bromobenzamide, 95%, N-((4-Aminophenyl)methyl)-4-bromobenzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
N-[(4-aminophenyl)methyl]-4-bromobenzamide (CAS 1175834-19-1) is a chemical compound with the molecular formula C14H13BrN2O and a molecular weight of 305.17 g/mol. IUPAC name: N-[(4-aminophenyl)methyl]-4-bromobenzamide. InChIKey: SNMJPZWMBURWQL-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2O |
|---|---|
| Molecular weight | 305.17 g/mol |
| IUPAC name | N-[(4-aminophenyl)methyl]-4-bromobenzamide |
| InChIKey | SNMJPZWMBURWQL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC(=O)C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)