CAS 897016-93-2 is the registry number for N-Benzyl-2-(5-bromopyridin-2-yl)acetamide, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
N-benzyl-2-(5-bromo-2-pyridinyl)acetamide (CAS 897016-93-2) is a chemical compound with the molecular formula C14H13BrN2O and a molecular weight of 305.17 g/mol. IUPAC name: N-benzyl-2-(5-bromo-2-pyridinyl)acetamide. InChIKey: MFVMVBWFPPMPFW-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2O |
|---|---|
| Molecular weight | 305.17 g/mol |
| IUPAC name | N-benzyl-2-(5-bromo-2-pyridinyl)acetamide |
| InChIKey | MFVMVBWFPPMPFW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)CC2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)