CAS 930713-46-5 is the registry number for 4-Bromo-N-(2,3-dihydro-1H-inden-5-yl)-1H-pyrrole-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-N-(2,3-dihydro-1H-inden-5-yl)-1H-pyrrole-2-carboxamide (CAS 930713-46-5) is a chemical compound with the molecular formula C14H13BrN2O and a molecular weight of 305.17 g/mol. IUPAC name: 4-bromo-N-(2,3-dihydro-1H-inden-5-yl)-1H-pyrrole-2-carboxamide. InChIKey: OWFFLPMGEHYLPQ-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2O |
|---|---|
| Molecular weight | 305.17 g/mol |
| IUPAC name | 4-bromo-N-(2,3-dihydro-1H-inden-5-yl)-1H-pyrrole-2-carboxamide |
| InChIKey | OWFFLPMGEHYLPQ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)NC(=O)C3=CC(=CN3)Br |
Computed by PubChem (NCBI)