CAS 931000-82-7 is the registry number for 3-Bromo-N-(1-(pyridin-2-yl)ethyl)benzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-N-(1-pyridin-2-ylethyl)benzamide (CAS 931000-82-7) is a chemical compound with the molecular formula C14H13BrN2O and a molecular weight of 305.17 g/mol. IUPAC name: 3-bromo-N-(1-pyridin-2-ylethyl)benzamide. InChIKey: LHWFFRLMPXKTPP-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2O |
|---|---|
| Molecular weight | 305.17 g/mol |
| IUPAC name | 3-bromo-N-(1-pyridin-2-ylethyl)benzamide |
| InChIKey | LHWFFRLMPXKTPP-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=N1)NC(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)