CAS 117589-34-1 is the registry number for Ethyl (R)-2-(tosyloxy)propanoate. Offered by: TRC. Available pack sizes: 750mg.
Ethyl (2R)-2-(4-methylphenyl)sulfonyloxypropanoate (CAS 117589-34-1) is a chemical compound with the molecular formula C12H16O5S and a molecular weight of 272.32 g/mol. IUPAC name: ethyl (2R)-2-(4-methylphenyl)sulfonyloxypropanoate. InChIKey: SNLMUZGICZJWKN-SNVBAGLBSA-N.
| Molecular formula | C12H16O5S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | ethyl (2R)-2-(4-methylphenyl)sulfonyloxypropanoate |
| InChIKey | SNLMUZGICZJWKN-SNVBAGLBSA-N |
| SMILES | CCOC(=O)[C@@H](C)OS(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)