Products 1176146-55-6
CAS 1176146-55-6 is the registry number for 4,6-Dimethyl-3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]pyridin-2(1h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
4,6-dimethyl-3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-1H-pyridin-2-one (CAS 1176146-55-6) is a chemical compound with the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. IUPAC name: 4,6-dimethyl-3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-1H-pyridin-2-one. InChIKey: VRUOZTHSAKUMBH-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O2 |
|---|---|
| Molecular weight | 281.31 g/mol |
| IUPAC name | 4,6-dimethyl-3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-1H-pyridin-2-one |
| InChIKey | VRUOZTHSAKUMBH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NOC(=N2)C3=C(C=C(NC3=O)C)C |
Computed by PubChem (NCBI)